| Name | 2,3-dibromopropionitrile |
| Synonyms | DBPN Dibromopropionitrile 2,5-Dibromopropionitrile 2,3-Dibromopropionitrile 2,3-dibromopropionitrile 2,3-Dibromorpropionitrile 2,3-dibromopropiononitrile |
| CAS | 4554-16-9 |
| EINECS | 224-925-6 |
| InChI | InChI=1/C3H3Br2N/c4-1-3(5)2-6/h3H,1H2/t3-/m1/s1 |
| Molecular Formula | C3H3Br2N |
| Molar Mass | 212.87 |
| Density | 2.14 |
| Melting Point | 131-132 °C |
| Boling Point | 173°C |
| Flash Point | 172°F |
| Vapor Presure | 1.29mmHg at 25°C |
| Storage Condition | Room Temprature |
| Refractive Index | 1.545 |
| Physical and Chemical Properties | Boiling point 173 ℃, relative density 2.140, refractive index 1.5452, flash point 77 ℃. |
| Use | Used as an intermediate in organic synthesis |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22/21/22 - R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37 - Wear suitable protective clothing and gloves. |
| Hazard Class | IRRITANT |
| chemical properties | boiling point 173 ℃, relative density 2.140, refractive index 1.5452, flash point 77 ℃. |
| use | used in organic synthesis, production of propiononitrile, etc. used as an intermediate in organic synthesis |
| production method | obtained by the addition of acrylonitrile and bromine. Acrylonitrile was added to the glass reactor, stirred and cooled to 16°C, bromine was added dropwise under light irradiation, and the dropping acceleration was controlled so that the reaction temperature did not exceed 30°C. After dripping, continue stirring until the bromine color fades. Distillate under reduced pressure and collect the fraction at 105-112 ℃(2.66kPa) to obtain the finished product. 85% yield. |
| NIST chemical information | The information is: webbook.nist.gov provides (external link) |
| EPA chemical information | The information is: offered by ofmpub.epa.gov (external link) |