| Name | 2-Dicyclohexylphosphino-2'-(N,N-dimethylamino)biphenyl |
| Synonyms | DAVEPHOS dave-phos 2-Dicyclohexylphosphino-2'-(N, 2-Dicyclohexylphosphino-2'-(N,N-dimethylamino)- 2-(DICYCLOHEXYLPHOSPHINO)-2'-(DIMETHYLAMINO)BIPHENYL 2-Dicyclohexylphosphino-2'-(N,N-dimethylamino)biphenyl 2-DICYCLOHEXYLPHOSPHINO-2'-(N,N-DIMETHYLAMINO)BIPHENYL [1,1''-BIPHENYL]-2-AMINE, 2''-(DICYCLOHEXYLPHOSPHINO)-N,N-DIMETHYL- |
| CAS | 213697-53-1 |
| EINECS | 606-749-5 |
| InChI | InChI=1/C26H36NP/c1-27(2)25-19-11-9-17-23(25)24-18-10-12-20-26(24)28(21-13-5-3-6-14-21)22-15-7-4-8-16-22/h9-12,17-22H,3-8,13-16H2,1-2H3 |
| InChIKey | ZEMZPXWZVTUONV-UHFFFAOYSA-N |
| Molecular Formula | C26H36NP |
| Molar Mass | 393.54 |
| Melting Point | 121-124°C(lit.) |
| Boling Point | 539.6±43.0 °C(Predicted) |
| Flash Point | 280.1°C |
| Water Solubility | Insoluble |
| Vapor Presure | 1.04E-11mmHg at 25°C |
| Appearance | Light yellow crystal |
| Color | white |
| pKa | 5.04±0.18(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Sensitive | Air Sensitive |
| MDL | MFCD02183572 |
| Physical and Chemical Properties | White crystals |
| Use | Effective ligands for palladium-catalyzed C- N bond formation; amine? of aryl halides containing hydroxyl, amide, or enolone. Palladium catalyzes the ligand of Suzuki aryl-aryl coupling reaction to produce benzodioxegenin. |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29310099 |
| Hazard Class | AIR SENSITIVE |
| Use | As a ligand, used in coupling reactions such as Suzuki, Buchwald and substitution reactions Effective ligand for palladium-catalyzed C- N bond formation; Amine of aryl halides containing hydroxyl, amide or enolone? Chemical reaction. Palladium catalyzes the ligand of Suzuki aryl-aryl coupling reaction to produce benzodioxane. The complex with transition metals is used as a catalyst for organic synthesis such as C- C/C-N/C-O coupling reactions; used for palladium-catalyzed Suzuki aryl coupling to prepare benzodioxepine ligands; used for palladium-catalyzed C- N bonding reactions and effective ligands in the amination reaction of aryl halides containing hydroxyl, amide or enolated ketones |