| Name | Dapoxetine |
| Synonyms | DAPOXETIN Detoxetine Dapoxetine DAPOXETINE Dapoxetine-d7 HCl (S)-(+)-Dapoxetine Dapoxetine hydrochloride N,N-dimethyl-3-(2-naphthyloxy)-1-phenyl-propan-1-amine (S)-(+)--N,N-Dimethyl-1-phenyl-3-(1-naphthalenyloxy)propanamine (1S)-N,N-dimethyl-3-(naphthalen-1-yloxy)-1-phenylpropan-1-amine (aS)-N,N-Dimethyl-a-[2-(1-naphthalenyloxy)ethyl]benzenemethanamine (S)-(+)-N,N-dimethyl-a-(2-(naphthalenyloxy)ethyl)benzenemethanamine Dapoxetine hydrochloride (S-(+)-N,N-Dimethyl-a-[2-(naphthalenyloxy)ethyl]benzenemethanamine hydrochloride |
| CAS | 119356-77-3 |
| EINECS | 1308068-626-2 |
| InChI | InChI=1/C21H23NO/c1-22(2)21(18-9-4-3-5-10-18)14-15-23-20-13-12-17-8-6-7-11-19(17)16-20/h3-13,16,21H,14-15H2,1-2H3 |
| Molecular Formula | C21H23NO |
| Molar Mass | 305.41 |
| Density | 1.081±0.06 g/cm3(Predicted) |
| Melting Point | 48 - 49°C |
| Boling Point | 454.4±38.0 °C(Predicted) |
| Flash Point | 132.6°C |
| Solubility | Chloroform (Slightly), DMSO (Slightly, Heated), Methanol (Slightly) |
| Vapor Presure | 1.91E-08mmHg at 25°C |
| Appearance | Solid |
| Color | White to Pale Beige |
| pKa | 8.38±0.50(Predicted) |
| Storage Condition | -20°C Freezer |
| Refractive Index | 1.607 |
| Physical and Chemical Properties | White crystalline powder, odorless sweet, hygroscopic, soluble in water, the nature of a more stable melting point of 175~177 ℃. |