| Name | Triethylgermanium chloride |
| Synonyms | Triethylchlorogermane Triethylchlorogermene TRIETHYLCHLOROGERMANE Chlorotriethylgermane Triethylgermyl chloride TRIETHYLGERMANIUM CHLORIDE Triethylgermanium chloride triethylgermanylium chloride Chlorotriethylgermane,Triethylgermanium chloride |
| CAS | 994-28-5 |
| EINECS | 213-614-0 |
| InChI | InChI=1/C6H15Ge.ClH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H/q+1;/p-1 |
| Molecular Formula | C6H15ClGe |
| Molar Mass | 195.28 |
| Density | 1.175g/mLat 25°C(lit.) |
| Melting Point | <-50°C |
| Boling Point | 173°C(lit.) |
| Flash Point | >230°F |
| Water Solubility | Insoluble in water. |
| Appearance | liquid |
| Specific Gravity | 1.175 |
| Color | colorless |
| Storage Condition | Room Temprature |
| Sensitive | 7: reacts slowly with moisture/water |
| Refractive Index | n20/D 1.459(lit.) |
| MDL | MFCD00013591 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36 - Irritating to the eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Hazard Class | 8 |
| Packing Group | II |