| Name | 2-chloro-5-nitrotoluene |
| Synonyms | Chloronitroluene 2-Chloro-5-nitroluene 2-Chloro-5-nitrotolune 2-Chloro-5-nitrotoluene 2-chloro-5-nitrotoluene 2-CHLORO-5-NITROTOLUENE 5-NITRO-2-CHLOROTOLUENE 4-CHLORO-3-METHYLNITROBENZENE 2-CHLORO-5-NITROMETHYLBENZENE 1-chloro-2-methyl-4-nitro-benzen 2-CHLORO-1-METHYL-5-NITROBENZENE 1-chloro-2-methyl-4-nitrobenzene BENZENE, 2-CHLORO-1-METHYL-5-NITRO- |
| CAS | 13290-74-9 |
| EINECS | 236-306-8 |
| InChI | InChI=1/C7H6ClNO2/c1-5-4-6(9(10)11)2-3-7(5)8/h2-4H,1H3 |
| InChIKey | BGDCQZFFNFXYQC-UHFFFAOYSA-N |
| Molecular Formula | C7H6ClNO2 |
| Molar Mass | 171.58 |
| Density | 1.3246 (rough estimate) |
| Melting Point | 40-44 °C |
| Boling Point | 94-96°C 4mm |
| Flash Point | 94-96°C/4mm |
| Vapor Presure | 0.0212mmHg at 25°C |
| Appearance | White powder |
| BRN | 2044766 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5377 (estimate) |
| MDL | MFCD00041430 |
| Physical and Chemical Properties | Appearance: light yellow crystals melting point 40-44°C |
| Use | Used for the synthesis of diazo photosensitive materials, microwave photography and other aspects; Pharmaceutical, veterinary intermediates |
| Risk Codes | R22 - Harmful if swallowed R52/53 - Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment. |
| Safety Description | S22 - Do not breathe dust. S36/37 - Wear suitable protective clothing and gloves. S61 - Avoid release to the environment. Refer to special instructions / safety data sheets. |
| UN IDs | UN 3457 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | Yes |
| Hazard Class | 6.1 |
| Packing Group | III |
| Use | Used for synthesizing diazo photosensitive materials, microwave photography, etc. Used for synthesizing diazo photosensitive materials, microwave photography, etc. |
| EPA chemical information | information provided by: ofmpub.epa.gov (external link) |