| Name | 4-Chloro-4-hydroxybiphenyl |
| Synonyms | AKOS BAR-1044 Chlorohydroxybiphenyl 4-CHLOROBIPHENYL-4-OL 4'-CHLORO-4-BIPHENYLOL 4'-CHLOROBIPHENYL-4-OL 4'-chlorobiphenyl-4-ol 4-Chloro-4-hydroxybiphenyl 4-Hydroxy-4'-chlorobiphenyl 4-CHLORO-4'-HYDROXYBIPHENYL 4'-CHLORO[1,1'-BIPHENYL]-4-OL |
| CAS | 28034-99-3 |
| InChI | InChI=1/C12H9ClO/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8,14H |
| Molecular Formula | C12H9ClO |
| Molar Mass | 204.65 |
| Density | 1.239±0.06 g/cm3(Predicted) |
| Melting Point | 146°C |
| Boling Point | 335.0±17.0 °C(Predicted) |
| Flash Point | 156.4°C |
| Solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 6.32E-05mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| pKa | 9.61±0.26(Predicted) |
| Storage Condition | -20°C Freezer, Under inert atmosphere |
| Refractive Index | 1.615 |
| MDL | MFCD00143298 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| Use | 4-chlorobiphenyl-4-ol is also called 4'-chloro-[1,1 '-biphenyl]-4-ol, which can be used as a synthetic intermediate. |