| Name | 6-Chloro-2-hexanone |
| Synonyms | Chlorohexanone 6-Chloro-2-hexanol 6-CHLORO-2-HEXANONE 1-CHLORO-5-HEXANONE 6-Chloro-2-hexanone 6-CHLOROHEXAN-2-ONE 1-CHLOROHEXAN-5-ONE 1-Chlorohexane-5-one 4-CHLOROBUTYL METHYL KETONE |
| CAS | 10226-30-9 |
| EINECS | 233-546-5 |
| InChI | InChI=1/C6H11ClO/c1-6(8)4-2-3-5-7/h2-5H2,1H3 |
| Molecular Formula | C6H11ClO |
| Molar Mass | 134.6 |
| Density | 1.02 g/mL at 25 °C (lit.) |
| Boling Point | 85.5-86.5 °C/16 mmHg (lit.) |
| Flash Point | 195°F |
| Water Solubility | Insoluble in water, soluble in chloroform (chloroform, carbon), n-heptane, ethanol, butanol, etc. |
| Vapor Presure | 1.29-1.607hPa at 25℃ |
| Appearance | Liquid |
| Specific Gravity | 1.03 |
| Color | Clear yellow to brown |
| Storage Condition | Freezer |
| Refractive Index | n20/D 1.4435(lit.) |
| Physical and Chemical Properties | density 1.02 boiling point 85-87 ° C. (16 mmHg) refractive index 1.4425-1.4445 flash point 195 ° F. |
| Use | Used as an intermediate of pentoxifylline |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 29141990 |