| Name | 4-chlorobutyric acid |
| Synonyms | Cl(CH2)3COOH Levetiracetam-12 Chlorobutyricacid 4-chlorobutyric acid 4-Chlorobutanoicacid 4-chloro-butanoicaci 4-chlorobutanoic acid 4-Chlorobutanoic acid 4-chloro-Butanoicacid 4-Chloro-n-butyric acid Butyric acid, 4-chloro- gamma-Chloro-n-butyric acid |
| CAS | 627-00-9 |
| EINECS | 210-977-7 |
| InChI | InChI=1/C4H7ClO2/c5-3-1-2-4(6)7/h1-3H2,(H,6,7) |
| InChIKey | IPLKGJHGWCVSOG-UHFFFAOYSA-N |
| Molecular Formula | C4H7ClO2 |
| Molar Mass | 122.55 |
| Density | 1.24g/mLat 25°C(lit.) |
| Melting Point | 12-16°C(lit.) |
| Boling Point | 196°C22mm Hg(lit.) |
| Flash Point | >230°F |
| Solubility | soluble in Ether |
| Vapor Presure | 0.000131mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Almost colorless |
| BRN | 1700264 |
| pKa | 4.52(at RT℃) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.451(lit.) |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R22 - Harmful if swallowed R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 29159000 |
| Hazard Class | 8 |
| Packing Group | III |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |