| Name | 2-Chloro-4-bromobenzaldehyde |
| Synonyms | Chloro-4-bromobenzaldehyde 2-Chloro-4-bromobenzaldehyde 4-BROMO-2-CHLOROBENZALDEHYDE Benzaldehyde,4-broMo-2-chloro- |
| CAS | 158435-41-7 |
| InChI | InChI=1/C7H4BrClO/c8-6-2-1-5(4-10)7(9)3-6/h1-4H |
| Molecular Formula | C7H4BrClO |
| Molar Mass | 219.46 |
| Density | 1.698±0.06 g/cm3(Predicted) |
| Melting Point | 74-76℃ |
| Boling Point | 271.3±25.0 °C(Predicted) |
| Flash Point | 117.9°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 0.0065mmHg at 25°C |
| Appearance | White to bright yellow crystals |
| Color | White to Orange to Green |
| Storage Condition | Inert atmosphere,2-8°C |
| Sensitive | Air Sensitive |
| Refractive Index | 1.623 |
| MDL | MFCD08741413 |
| Physical and Chemical Properties | Sensitivity: Air Sensitive |
| Risk Codes | 22 - Harmful if swallowed |
| Hazard Note | Corrosive |