| Name | Cetirizine |
| Synonyms | vidix Ceterizine Cetirizine CETIRIZINE LACTOSE ESTER Cetirizine DISCONTINUED (Replaced with C1876) 2-[4-(4-Chlorobenzhydryl)-1-piperazinyl]ethoxyacetic acid 2-[2-[4-(4-Chlorobenzhydryl)-1-piperazinyl]ethoxy]acetic acid 5-[4-[(4-Chlorophenyl)phenylmethyl]piperazino]-3-oxapentanoic acid 2-[2-[4-[(4-chlorophenyl)-phenyl-methyl]piperazin-1-yl]ethoxy]acetic acid 2-(2-{4-[(R)-(4-chlorophenyl)(phenyl)Methyl]piperazin-1-yl}ethoxy)acetic acid |
| CAS | 83881-51-0 |
| InChI | InChI=1/C21H25ClN2O3/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26/h1-9,21H,10-16H2,(H,25,26) |
| Molecular Formula | C21H25ClN2O3 |
| Molar Mass | 388.89 |
| Density | 1.237±0.06 g/cm3(Predicted) |
| Melting Point | 110-115°C |
| Boling Point | 542.1±45.0 °C(Predicted) |
| Water Solubility | 101 mg/L |
| pKa | 3.46±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Physical and Chemical Properties | Melting point 110-115°C water-soluble 101 mg/L |
| Use | Used as an anti-allergic drug |
| WGK Germany | 3 |
| RTECS | AG0977500 |
crystallized from ethanol, melting point 110-115 °c.
N-(4-chlorophenyl) phenylmethyl] piperazine was reacted with 2-(2-chloroethoxy) acetic acid to give cetirizine.
developed by joint Chemical Company, Belgium, launched in 1987. Anti-allergic drugs have long-acting selectivity and strong Hi receptor activity without sedative side effects. For allergic diseases of the respiratory system, skin and eyes, including chronic idiopathic urticaria, perennial sexually allergic nose
Inflammation, hay fever, mild sedative effect or dry oral mucosa.