| Name | L-701,324 |
| Synonyms | L-701 CS-2045 L-701,324 L-701,304 7-Chloro-4-hydroxy-3-(3-phenoxy)phenyl-2(H)-quinolinone 7-chloro-1-(4-hydroxy-3-phenoxyphenyl)quinolin-2(1H)-one 7-chloro-4-hydroxy-3-(3-phenoxyphenyl)-1H-quinolin-2-one 7-CHLORO-4-HYDROXY-3-(3-PHENOXY)PHENYL-2(1H)-QUINOLINONE 7-CHLORO-4-HYDROXY-3-(3-PHENOXY )PHENYLQUINOLIN-2[1H]-ONE |
| CAS | 142326-59-8 |
| InChI | InChI=1/C21H14ClNO3/c22-14-9-10-17-18(12-14)23-21(25)19(20(17)24)13-5-4-8-16(11-13)26-15-6-2-1-3-7-15/h1-12H,(H2,23,24,25) |
| Molecular Formula | C21H14ClNO3 |
| Molar Mass | 363.79 |
| Density | 1.389±0.06 g/cm3(Predicted) |
| Melting Point | 308 °C |
| Boling Point | 584.7±50.0 °C(Predicted) |
| Flash Point | 280.9°C |
| Solubility | DMSO: soluble36.4mg/mL |
| Vapor Presure | 1.57E-12mmHg at 25°C |
| Appearance | solid |
| pKa | 4.50±1.00(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.679 |
| Physical and Chemical Properties | WGK Germany:3 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| 1mg | 5mg | 10mg | |
|---|---|---|---|
| 1 mM | 2.749 ml | 13.744 ml | 27.488 ml |
| 5 mM | 0.55 ml | 2.749 ml | 5.498 ml |
| 10 mM | 0.275 ml | 1.374 ml | 2.749 ml |
| 5 mM | 0.055 ml | 0.275 ml | 0.55 ml |