| Name | cis-Stilbene |
| Synonyms | Stilbebe cis-Stilbebe cis-Stilbene cis-1,2-Diphenylethylene ((E)-2-phenylethenyl)benzene cis-1,1-(1,2-Ethenediyl)bis(benzene) cis-Stilbene, (cis-1,2-Diphenylethylene) |
| CAS | 645-49-8 |
| EINECS | 211-445-7 |
| InChI | InChI=1/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
| Molecular Formula | C14H12 |
| Molar Mass | 180.24 |
| Density | 1.01 |
| Melting Point | -5℃ |
| Boling Point | 82-84℃ (0.4 torr) |
| Flash Point | >230 °F |
| Water Solubility | Immiscible with water. Miscible with ethanol. |
| Refractive Index | 1.621 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/38 - Irritating to eyes and skin. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. |
| Raw Materials | Benzene, 1-[(phenylmethyl)sulfonyl]-3,5-bis(trifluoromethyl)- 3,5-Bis(trifluoromethyl)phenol TRANS-STILBENE |
| Downstream Products | (1R,2R)-(+)-1-PHENYLPROPYLENE OXIDE |
| storage conditions | 2-8°C |
| water solubility | Immiscible with water. Miscible with ethanol. |
| Merck | 14,8817 |
| BRN | 1616739 |
| stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| EPA chemical information | cis-Stilbene (645-49-8) |
| WGK Germany | 3 |
| RTECS number | DA0513600 |
| customs code | 29029090 |
| toxic substance data | 645-49-8(Hazardous Substances Data) |