| Name | Diphenylchlorosilane |
| Synonyms | Chlorodiphenylsilane CHLORODIPHENYLSILANE DIPHENYLCHLOROSILANE chlorodiphenyl-silan Diphenylchlorosilane chloro(diphenyl)silyl Diphenylsilyl chloride Silane, chlorodiphenyl- Diphenylchlorosilane (PURITY??) |
| CAS | 1631-83-0 |
| EINECS | 216-634-8 |
| InChI | InChI=1/C12H10ClSi/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | VTMOWGGHUAZESJ-UHFFFAOYSA-N |
| Molecular Formula | C12H11ClSi |
| Molar Mass | 218.75 |
| Density | 1.118g/mLat 25°C(lit.) |
| Boling Point | 143°C10mm Hg(lit.) |
| Flash Point | >230°F |
| Water Solubility | Reacts with water. |
| Solubility | sol benzene, chloroform, carbon tetrachloride, andether. |
| Specific Gravity | 1.118 |
| BRN | 2937164 |
| Storage Condition | Room Temprature |
| Sensitive | Moisture Sensitive |
| Refractive Index | n20/D 1.578(lit.) |
| MDL | MFCD00045144 |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R14 - Reacts violently with water R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S28 - After contact with skin, wash immediately with plenty of soap-suds. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2987 8/PG 2 |
| WGK Germany | 1 |
| FLUKA BRAND F CODES | 10-21 |
| TSCA | Yes |
| HS Code | 29319090 |
| Hazard Class | 8 |
| Packing Group | II |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |