| Name | 5-Amino-6-Chloro-2-Methylphenol |
| Synonyms | CAOC 5-AMINO-6-CHLORO-O-CRESOL 6-chloro-5-amino-o-cresol 6-Chloro-5-amino ortho cresol 3-amino-2-chlor-6-methylphenol 3-AMINO-2-CHLORO-6-METHYLPHENOL 5-AMINO-6-CHLORO-2-METHYLPHENOL 5-Amino-6-Chloro-2-Methylphenol 2-METHYL-5-AMINO-6-CHLOROPHENOL 2-chloro-3-amino-6-methylphenol |
| CAS | 84540-50-1 |
| EINECS | 283-144-9 |
| InChI | InChI=1/C7H8ClNO/c1-4-2-3-5(9)6(8)7(4)10/h2-3,10H,9H2,1H3 |
| Molecular Formula | C7H8ClNO |
| Molar Mass | 157.6 |
| Density | 1.331±0.06 g/cm3(Predicted) |
| Melting Point | 80-83°C |
| Boling Point | 262.7±35.0 °C(Predicted) |
| Flash Point | 112.6°C |
| Vapor Presure | 0.061-2.2Pa at 20-50℃ |
| Appearance | White crystal |
| Color | White to Orange to Green |
| pKa | 8.89±0.15(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.629 |
| Physical and Chemical Properties | White powder. |
| Risk Codes | R22 - Harmful if swallowed R36 - Irritating to the eyes |
| Hazard Note | Irritant |
| LogP | 1.644 at 23℃ and pH7.27 |
| surface tension | 63.1mN/m at 1g/L and 21 ℃ |