| Name | 1,2-Bis(phenylthio)ethane |
| Synonyms | AKOS BBS-00004432 Bis(phenylthio)ethane 1,2-Di(phosphino)ethane 1,2-Bis(phenylthio)ethane 1,2-Di(phenylthio) ethane 1,1'-[ethane-1,2-diylbis(thio)]bisbenzene ([2-(Phenylsulfanyl)ethyl]sulfanyl)benzene Benzene, 1,1'-[1,2-ethanediylbis(thio)]bis- 1,1'-(ethane-1,2-diyldisulfanediyl)dibenzene |
| CAS | 622-20-8 |
| EINECS | 210-723-5 |
| InChI | InChI=1/C14H14S2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| Molecular Formula | C14H14S2 |
| Molar Mass | 246.39 |
| Density | 1.16±0.1 g/cm3(Predicted) |
| Melting Point | 68 °C |
| Boling Point | 65 °C / 3mmHg |
| Flash Point | 184.6°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 1.48E-05mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| BRN | 1877719 |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.646 |
| MDL | MFCD00014085 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| TSCA | Yes |
| HS Code | 29309090 |
| Hazard Class | STENCH |
| LogP | 5.27 at 30℃ |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |