| Name | Oxalic acid bis(cyclohexylidenehydrazide) |
| Synonyms | CUPRIZON cuprizon CUPRIZONE Cuprizon 1 CUPRIZON I Cuprizon l CUPRIZON 1 CUPFERAZONE CUPRIZONE I DICYCLOHEXANONE OXALYLDIHYDRAZONE Bis(cyclohexanone)oxaldihydrazone BIS(CYCLOHEXANONE) OXALDIHYDRAZONE oxalic bis(cyclohexylidenehydrazide) N,N-oxalylbis(cyclohexanone hydrazone) Oxalic acid bis(cyclohexylidenehydrazide) Oxalic acid bis (cyclohexylidenehydrazide) N'~1~,N'~2~-dicyclohexylideneethanedihydrazide |
| CAS | 370-81-0 |
| EINECS | 206-729-2 |
| InChI | InChI=1/C14H22N4O2/c19-13(17-15-11-7-3-1-4-8-11)14(20)18-16-12-9-5-2-6-10-12/h1-10H2,(H,17,19)(H,18,20) |
| Molecular Formula | C14H22N4O2 |
| Molar Mass | 278.35 |
| Density | 1.0823 (rough estimate) |
| Melting Point | 210-214°C(lit.) |
| Boling Point | 421.17°C (rough estimate) |
| Water Solubility | Soluble in alcohol. Insoluble in water. |
| Solubility | Soluble in hot methanol and ethanol, insoluble in water. |
| Appearance | White crystal |
| Color | White |
| BRN | 2388004 |
| pKa | 10.78±0.20(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.6200 (estimate) |
| MDL | MFCD00001659 |
| Use | As a sensitive reagent for the determination of copper |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 21/22 - Harmful in contact with skin and if swallowed. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S2 - Keep out of the reach of children. |
| WGK Germany | 3 |
| RTECS | RO2520000 |
| TSCA | Yes |
| HS Code | 29280090 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | as a sensitive reagent for the determination of copper photometric determination of copper (II); experimental study on mitochondrial metabolism |