| Name | Diisobutylether |
| Synonyms | Diisobutylether Diisobutyl ether Bis(2-methylpropyl)ether 1,1'-oxybis[2-methyl-propan 1-Isobutoxy-2-methylpropane 1-Isobutoxy-2-methyl-propane 1,1'-oxybis[2-methylpropane] 1,1'-oxybis(2-methyl)-propan 1,1'-oxybis(2-methylpropane) Propane, 1,1'-oxybis*2-methyl- 2-methyl-1-(2-methylpropoxy)propane |
| CAS | 628-55-7 |
| EINECS | 211-045-2 |
| InChI | InChI=1/C8H18O/c1-7(2)5-9-6-8(3)4/h7-8H,5-6H2,1-4H3 |
| Molecular Formula | C8H18O |
| Molar Mass | 130.23 |
| Density | 0,75 g/cm3 |
| Melting Point | -100°C |
| Boling Point | 122°C |
| Flash Point | 8°C |
| Water Solubility | 137.9g/L(25 ºC) |
| Vapor Presure | 16.2mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Almost colorless |
| Merck | 14,5142 |
| Stability | Flammable. Incompatible with strong oxidizing agents. |
| Refractive Index | 1.3890-1.3910 |
| Risk Codes | 11 - Highly Flammable |
| Safety Description | S9 - Keep container in a well-ventilated place. S16 - Keep away from sources of ignition. S33 - Take precautionary measures against static discharges. |
| UN IDs | 3271 |
| RTECS | NQ1000000 |
| Hazard Class | 3.1 |
| Packing Group | III |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Overview | isobutyl ether can be used as a heptane booster for diesel fuel; studies have disclosed examples of diesel formulations containing isobutyl ether. The preparation of isobutyl ethers from butanol is known and is generally carried out by dehydration of n-butanol with sulfuric acid, or catalytic dehydration at elevated temperatures on ferric chloride, copper sulfate, silica or silicon-aluminium. Efforts aimed at improving air quality and increasing energy production from renewable resources have led to renewed interest in alternative fuels, such as ethanol and butanol, which can replace gasoline and diesel fuel. Efforts are currently being made to improve the efficiency of 1-butanol production by fermenting microorganisms that utilize renewable feedstocks, such as corn waste and bagasse, as a carbon source. It would be desirable to be able to utilize such isobutanol streams for the preparation of fuel additives, such as isobutyl ether. |