| Name | Benzothiazole-2-acetonitrile |
| Synonyms | AURORA KA-6243 2-BENZOTHIAZOLEACETONITRILE 2-Benzothiazoleacetonitrile 2-(Cyanomethyl)benzothiazole Benzothiazole-2-acetonitrile 2-Cyanomethyl-1,3-benzothiazole 1,3-BENZOTHIAZOL-2-YLACETONITRILE 1,3-benzothiazol-2-ylacetonitrile 2-(1,3-BENZOTHIAZOL-2-YL)ACETONITRILE methyl 5-(3-aminophenyl)furan-2-carboxylate |
| CAS | 56278-50-3 |
| EINECS | 627-570-9 |
| InChI | InChI=1/C9H6N2S.ClH/c10-6-5-9-11-7-3-1-2-4-8(7)12-9;/h1-4H,5H2;1H |
| Molecular Formula | C9H6N2S |
| Molar Mass | 174.22 |
| Density | 1.315±0.06 g/cm3(Predicted) |
| Melting Point | 98-101 °C (lit.) |
| Boling Point | 329.6±25.0 °C(Predicted) |
| Water Solubility | Slightly soluble in water. |
| Appearance | Yellow to or orange powder |
| BRN | 128460 |
| pKa | 0.10±0.10(Predicted) |
| Storage Condition | 2-8°C |
| MDL | MFCD00051633 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | 3439 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| Hazard Class | 6.1 |
| Packing Group | III |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |