| Name | Benzoylhydrazine |
| Synonyms | AKOS 90783 Benzhydrazide benzohydrazide Benzolhydrazine Benzoylhydrazine Benzoyl hydrazine AKOS BBS-00004503 benzoic hydrazide Benzoyl-hydrazine) Azelastine Impurity A Benzoic acid hydrazide benzoic acid hydrozide Azelastine HCl EP Impurity A Azelastine Impurity 3(EP Impurity A) Benzhydrazide, (Benzoic acid hydrazide |
| CAS | 613-94-5 |
| EINECS | 210-363-9 |
| InChI | InChI=1/C7H8N2O/c8-9-7(10)6-4-2-1-3-5-6/h1-5H,8H2,(H,9,10) |
| InChIKey | WARCRYXKINZHGQ-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O |
| Molar Mass | 136.15 |
| Density | 1.1778 (rough estimate) |
| Melting Point | 112-114 °C (lit.) |
| Boling Point | 250.42°C (rough estimate) |
| Flash Point | 139.7°C |
| Vapor Presure | 0.000315mmHg at 25°C |
| Appearance | Needle-Like Crystals or Powder |
| Color | White to beige |
| BRN | 471797 |
| pKa | pK1: 3.03(+2);pK2: 12.45(+1) (25°C) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | Sensitive to humidity |
| Refractive Index | 1.5460 (estimate) |
| MDL | MFCD00007596 |
| Physical and Chemical Properties | White to yellowish crystals. |
| Use | For Organic synthesis |
| Hazard Symbols | T - Toxic![]() |
| Risk Codes | R25 - Toxic if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DH1575000 |
| TSCA | Yes |
| HS Code | 29280090 |
| Hazard Class | IRRITANT |
| Packing Group | Ⅲ |
| Toxicity | LD50 scu-mus: 122 mg/kg JPETAB 122,110,58 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | for organic synthesis |
| category | toxic substances |
| toxicity grade | high toxicity |
| Acute toxicity | subcutaneous-mouse LD50: 122 mg/kg; Subcutaneous-rabbit LDL0: 102 mg/kg |
| explosive hazard characteristics | reaction with phenylselenic acid |
| flammability hazard characteristics | flammability; Toxic NOx smoke from combustion |
| storage and transportation characteristics | ventilation and low temperature drying; Separate storage |
| fire extinguishing agent | dry powder, foam, sand, carbon dioxide, water mist |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |