| Name | 2,5-dichloroanisole |
| Synonyms | Banair 2,5-dichloroanisole 2,5-Dichloroanisole 2,5-DICHLOROANISOLE Anisole, 2,5-dichloro- 2,5-DICHLOROMETHOXYBENZENE 1,4-DICHLORO-2-METHOXYBENZENE 1,4-Dichloro-2-methoxybenzene 1,4-dichloro-2-methoxy-benzen Benzene, 1,4-dichloro-2-methoxy- 1,4-Dichloro-2-methoxybenzene, 2,5-Dichlorophenyl methyl ether |
| CAS | 1984-58-3 |
| EINECS | 217-852-6 |
| InChI | InChI=1/C7H6Cl2O/c1-10-7-4-5(8)2-3-6(7)9/h2-4H,1H3 |
| Molecular Formula | C7H6Cl2O |
| Molar Mass | 177.03 |
| Density | 1.33 |
| Melting Point | 24°C |
| Boling Point | 128-132°C 3,5mm |
| Flash Point | 21°C |
| Vapor Presure | 0.185mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear colorless to very slightly yellow |
| BRN | 2327401 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.5615-1.5635 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/22 - Harmful by inhalation and if swallowed. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S23 - Do not breathe vapour. |
| UN IDs | 1993 |
| TSCA | Yes |
| HS Code | 29093090 |
| Hazard Note | Irritant |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |