| Name | Benzyl Sulfide |
| Synonyms | BENZYLSULFID BENZYLSULPHIDE BENZYL SULFIDE Benzyl Sulfide Dibenzyl sulfid Sulfide,benzyl- benzyl thioether DIBENZYL SULFIDE dibenzyl sulfide Dibenzyl sulphide DIBENZYL SULPHIDE dibenzyl thioether benzyl monosulfide dibenzyl monosulfide 1,3-Diphenyl-2-thiapropane [(Benzylsulfanyl)methyl]benzene Benzene,1,1'-[thiobis(methylene)]bis Benzene, 1,1'-[thiobis(methylene)]bis- 1,1'-(sulfanediyldimethanediyl)dibenzene |
| CAS | 538-74-9 |
| EINECS | 208-703-6 |
| InChI | InChI=1/C14H14S/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| Molecular Formula | C14H14S |
| Molar Mass | 214.33 |
| Density | 1.0880 |
| Melting Point | 44-47 °C (lit.) |
| Boling Point | 131 °C / 2mmHg |
| Flash Point | >110°C |
| Vapor Presure | 0.000516mmHg at 25°C |
| Appearance | Crystals |
| Color | White |
| Merck | 14,1145 |
| BRN | 1911157 |
| Storage Condition | 0-10°C |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive Index | 1.6170 (estimate) |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| UN IDs | UN 3335 |
| WGK Germany | 2 |
| RTECS | DC0512500 |
| FLUKA BRAND F CODES | 13 |
| TSCA | Yes |
| HS Code | 29309090 |
| Toxicity | LD50 orl-rat: >2 g/kg ATDAEI 15(Suppl 1),S89,1996 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| category | toxic substances |
| toxicity classification | poisoning |
| acute toxicity | oral-rat LD50: > 2000 mg/kg |
| flammability hazard characteristics | combustible; combustion produces toxic sulfur oxide smoke |
| storage and transportation characteristics | ventilation and low temperature drying |
| fire extinguishing agent | dry powder, foam, sand, carbon dioxide, mist water |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |