| Name | Thiosinamine |
| Synonyms | AMINOSIN RHODALLINE tiosinamine Thiosinamine Allylthiourea Allyl thiourea N-ALLYLTHIOUREA PROPENYLTHIOUREA N-PROPYLE ACETATE 1-ALLYL-2-THIOUREA ALLYLTHIOCARBAMIDE Propenyl sulfourea N-(2-PROPENYL)THIOUREA LABOTEST-BB LT00025093 1-prop-2-en-1-ylthiourea 1-(prop-2-en-1-ylsulfanyl)urea Allylthiourea, (Thiosinamine) |
| CAS | 185147-29-9 109-57-9 |
| EINECS | 203-683-5 |
| InChI | InChI=1/C4H8N2OS/c1-2-3-8-6-4(5)7/h2H,1,3H2,(H3,5,6,7) |
| Molecular Formula | C4H8N2S |
| Molar Mass | 116.18 |
| Density | 1.11g/mLat 25°C(lit.) |
| Melting Point | 70-72°C(lit.) |
| Water Solubility | 67 g/L (20℃) |
| Appearance | White crystal |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.539 |
| MDL | MFCD00004940 |
| Physical and Chemical Properties | WGK Germany:2 RTECS:YR8050000 |
| Use | Used as cyanide-free copper additive, preservative, also used in organic synthesis |
| Hazard Symbols | T - Toxic![]() |
| Risk Codes | 25 - Toxic if swallowed |
| Safety Description | 45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | YR8050000 |
| Use | Used as a cyanide-free copper plating additive, preservative, and also used in organic synthesis |