| Name | 3,4,5-Trimethoxyphenol |
| Synonyms | Anitarol ANTIAROL AI3-38432 3,4,5-Trimethoxyphen 3,4,5-Trimethoxyphenol 3,4,5-TRIMETHOXYPHENOL 1,3,5-TRIMETHOXYPHENOL Phenol, 3,4,5-trimethoxy- 5-HYDROXY-1,2,3-TRIMETHOXYBENZENE |
| CAS | 642-71-7 |
| EINECS | 211-387-2 |
| InChI | InChI=1/C9H12O4/c1-11-7-4-6(10)5-8(12-2)9(7)13-3/h4-5,10H,1-3H3 |
| InChIKey | VTCDZPUMZAZMSB-UHFFFAOYSA-N |
| Molecular Formula | C9H12O4 |
| Molar Mass | 184.19 |
| Density | 1.2067 (rough estimate) |
| Melting Point | 145-149 °C |
| Boling Point | 278.13°C (rough estimate) |
| Flash Point | 143.2°C |
| Solubility | Soluble in chloroform. |
| Vapor Presure | 0.000276mmHg at 25°C |
| Appearance | Powder and/or Chunks |
| Color | Light yellow to beige to light brown |
| BRN | 1958573 |
| pKa | 9.72±0.23(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Sensitive | Light Sensitive |
| Refractive Index | 1.4345 (estimate) |
| MDL | MFCD00008389 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| HS Code | 29095000 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| biological activity | Antiarol (3,4,5-trimethoxyphenol) is an aromatic phenol with moderate DPPH radical scavenging activity. |