| Name | 2-cyclohexylcyclohexanol |
| Synonyms | NSC 6094 AI3-01023 [Bicyclohexyl]-2-ol bi(cyclohexan)-2-ol 2-Cyclohexylcyclohexanol [1,1'-Bicyclohexyl]-2-ol 2-CYCLOHEXYLCYCLOHEXANOL 2-cyclohexylcyclohexanol (1,1'-Bicyclohexyl)-2-ol [1,1'-bicyclohexyl]-2-ol (Bicyclohexyl)-2-ol (8CI) Cyclohexanol, 2-cyclohexyl- EPA Pesticide Chemical Code 065001 2-Cyclohexylcyclohexanol (cis- and trans- mixture) |
| CAS | 6531-86-8 |
| EINECS | 229-430-9 |
| InChI | InChI=1/C12H22O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h10-13H,1-9H2 |
| Molecular Formula | C12H22O |
| Molar Mass | 182.3 |
| Density | 0.98 |
| Melting Point | 31 °C |
| Boling Point | 264 °C |
| Flash Point | 118.6°C |
| Vapor Presure | 0.000355mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Light yellow |
| pKa | 15.31±0.40(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.4980-1.5020 |
| MDL | MFCD00021278 |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |