| Name | 3,5-Dinitro-2-aminothiophene |
| Synonyms | ADNT 3,5-dinitro-2-thiophenamin 2,5-dinitrothiophen-2-amine 3,5-dinitrothiophen-2-amine 2-amino-3,5-dinitrothiophene 3,5-Dinitro-2-aminothiophene 2-AMINO-3,5-DINITROTHIOPHENE 2-Amino-3,5-dinitro thiophene 7-(4-fluorophenyl)-2-methyl-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidine |
| CAS | 2045-70-7 |
| EINECS | 218-065-0 |
| InChI | InChI=1/C4H3N3O4S/c5-4-2(6(8)9)1-3(12-4)7(10)11/h1H,5H2 |
| Molecular Formula | C4H3N3O4S |
| Molar Mass | 189.15 |
| Density | 1.715 (estimate) |
| Melting Point | 174-176°C(lit.) |
| Boling Point | 422°C at 760 mmHg |
| Flash Point | 209°C |
| Vapor Presure | 2.49E-07mmHg at 25°C |
| Storage Condition | Room Temprature |
| Refractive Index | 1.6320 (estimate) |
| Physical and Chemical Properties | Melting Point 174-176°C |
| Use | For the synthesis of dispersed Green 9# |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | used to synthesize dispersed green 9# |