| Name | 2,5-Difluorophenylhydrazine |
| Synonyms | 2,5-DIFLUOROPHENYLHYDRAZINE 2,5-Difluorophenylhydrazine 1,4-Difluoro-2-hydrazinobenzene Hydrazine, (2,5-difluorophenyl)- |
| CAS | 97108-50-4 |
| InChI | InChI=1/C6H6F2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2 |
| Molecular Formula | C6H6F2N2 |
| Molar Mass | 144.12 |
| Density | 1.379±0.06 g/cm3(Predicted) |
| Melting Point | 75-76°C(lit.) |
| Boling Point | 189.5±30.0 °C(Predicted) |
| Flash Point | 68.4°C |
| Vapor Presure | 0.567mmHg at 25°C |
| Appearance | Solid |
| Color | White to brown |
| pKa | 4.60±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.579 |
| MDL | MFCD00013384 |
| Use | Important Intermediates in Synthesis of 7-Fluorotryptophan Derivatives |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29280090 |
| Hazard Class | IRRITANT |
| Use | an important intermediate for the synthesis of 7-fluoro tryptophan derivatives. |