| Name | 2,5-Dimethylbenzylamine |
| Synonyms | TIMTEC-BB SBB005839 RARECHEM AL BW 0157 2,5-Dimethylbenzylamine 2,5-DIMETHYLBENZYLAMINE 2,5-dimethyl-benzenemethanamin 2,5-Dimethylbenzenemethanamine (2,5-DiMethylphenyl)MethanaMine (2,5-dimethylphenyl)methanaminium 1-(2,5-dimethylphenyl)methanamine Benzenemethanamine, 2,5-dimethyl- (2,5-dimethylphenyl)methylammonium N-[(2,5-DiMethylphenyl)Methyl]aMine |
| CAS | 93-48-1 |
| EINECS | 202-250-8 |
| InChI | InChI=1/C9H13N/c1-7-3-4-8(2)9(5-7)6-10/h3-5H,6,10H2,1-2H3/p+1 |
| Molecular Formula | C9H13N |
| Molar Mass | 135.21 |
| Density | 0.95 |
| Boling Point | 225 °C |
| Flash Point | 92.3°C |
| Vapor Presure | 0.0989mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear colorless |
| pKa | 9.31±0.10(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.535-1.538 |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | 34 - Causes burns |
| Safety Description | S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| UN IDs | 2735 |
| HS Code | 29214900 |
| Hazard Class | AIR SENSITIVE, CORRO |
| Packing Group | III |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |