| Name | 4-(trans-4-Ethylcyclohexyl)phenol |
| Synonyms | 4-Ethyl-Cyclohexyl Phenol 4-ETHYL-CYCLOHEXYL PHENOL 4-(trans-4-Ethylcyclohexyl)phen 4-(trans-4-Ethylcyclohexyl)phenol Phenol, 4-(trans-4-ethylcyclohexyl)- 4-(Trans-4-N-Ethylcyclohexyl)Phenol,2PcoC14H20O |
| CAS | 89100-78-7 |
| InChI | InChI=1/C14H20O/c1-2-11-3-5-12(6-4-11)13-7-9-14(15)10-8-13/h7-12,15H,2-6H2,1H3/t11-,12- |
| Molecular Formula | C14H20O |
| Molar Mass | 204.31 |
| Density | 0.988 |
| Melting Point | 127-129 °C |
| Boling Point | 324.5±21.0 °C(Predicted) |
| pKa | 10.21±0.30(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.524 |
| Use | 4-(trans-4-ethylcyclohexyl) phenol is a substituted (4 '-Hydroxyphenyl) cycloalkane compound, which can be used as a selective agonist of estrogen receptor β(ERβ), it can be formulated into a pharmaceutical composition and administered to treat diseases related to ER activity. 4-(trans-4-ethylcyclohexyl) phenol is mainly used as a raw material for the synthesis of liquid crystal monomers; pharmaceutical synthesis raw material. |