| Name | 2',3'-Dideoxyguanosine |
| Synonyms | DDG ddGuo 2',3'-DIDEOXYGUANOSINE 2',3'-Dideoxyguanosine 2',3'-Didioxyguanosine 2',3'-Dideoxy-D-guanosine Guanosine, 2',3'-dideoxy- BETA-D-2',3'-DIDEOXYGUANOSINE 2-Amino-9-[5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one 2-AMino-9-((2R,5S)-5-(hydroxyMethyl)tetrahydrofuran-2-yl)-1H-purin-6(9H)-one 2-amino-9-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-3,9-dihydro-6H-purin-6-one |
| CAS | 85326-06-3 |
| EINECS | 2017-001-1 |
| InChI | InChI=1/C10H13N5O3.C8H12N4O5/c11-10-13-8-7(9(17)14-10)12-4-15(8)6-2-1-5(3-16)18-6;9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h4-6,16H,1-3H2,(H3,11,13,14,17);2-5,8,13-15H,1H2,(H2,9,16)/t5-,6+;3-,4-,5-,8-/m01/s1 |
| InChIKey | OCLZPNCLRLDXJC-UHFFFAOYSA-N |
| Molecular Formula | C10H13N5O3 |
| Molar Mass | 251.24 |
| Density | 1.91±0.1 g/cm3(Predicted) |
| Boling Point | 632.1°C at 760 mmHg |
| Flash Point | 336.1°C |
| Vapor Presure | 7.6E-17mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-white |
| pKa | 9?+-.0.20(Predicted) |
| Storage Condition | Sealed in dry,2-8°C |
| MDL | MFCD00057074 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Reference Show more | 1. [IF=1.618] Wang Shengnan et al."Simultaneous Determination of Iridoid Glycosides, Phenylpropanoid Glycosides, Organic Acids, Nucleosides and Amino Acids in Scrophulariae Radix Processed by Different Processing Methods by HPLC-QTRAP-MS/MS."J Chromatogr Sci. 2021 Jun; |