| Name | 1H-indazole-5-carbonitrile |
| Synonyms | 5-Cyanoindazole 5-Cyano-1H-indazole Indazole-5-carbonitrile 1H-indazole-5-carbonitrile 1H-INDAZOLE-5-CARBONITRILE 1H-Indazole-5-carbonitrile(9CI) |
| CAS | 74626-47-4 |
| InChI | InChI=1/C8H5N3/c9-4-6-1-2-8-7(3-6)5-10-11-8/h1-3,5H,(H,10,11) |
| Molecular Formula | C8H5N3 |
| Molar Mass | 143.15 |
| Density | 1.33±0.1 g/cm3(Predicted) |
| Boling Point | 370.3±15.0 °C(Predicted) |
| Flash Point | 126.669°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 12.19±0.40(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.685 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| HS Code | 29339900 |
| Hazard Class | IRRITANT |