| Name | ethyl 3-oxotetradecanoate |
| Synonyms | NSC 512950 Ethyl dodecanoylacetate ETHYL 3-OXOTETRADECANOATE ethyl 3-oxotetradecanoate 3-Oxo-tetradecanoic acid ethyl ester Tetradecanoic acid, 3-oxo-, ethyl ester |
| CAS | 74124-22-4 |
| InChI | InChI=1/C16H30O3/c1-3-5-6-7-8-9-10-11-12-13-15(17)14-16(18)19-4-2/h3-14H2,1-2H3 |
| Molecular Formula | C16H30O3 |
| Molar Mass | 270.41 |
| Density | 0.922±0.06 g/cm3(Predicted) |
| Boling Point | 173-175℃ (10 Torr) |
| Flash Point | 126.8°C |
| Vapor Presure | 0.00065mmHg at 25°C |
| pKa | 10.67±0.46(Predicted) |
| Storage Condition | -20℃ |
| Refractive Index | 1.444 |
| 1mg | 5mg | 10mg | |
|---|---|---|---|
| 1 mM | 3.698 ml | 18.49 ml | 36.981 ml |
| 5 mM | 0.74 ml | 3.698 ml | 7.396 ml |
| 10 mM | 0.37 ml | 1.849 ml | 3.698 ml |
| 5 mM | 0.074 ml | 0.37 ml | 0.74 ml |
| Overview | ethyl lauroyl acetate is useful as a pharmaceutical synthesis intermediate. If ethyl lauroyl acetate is inhaled, move the patient to fresh air; If there is skin contact, remove the contaminated clothing and rinse the skin thoroughly with soap and water; if the eyes are in contact, the eyelids should be separated, washed with running water or normal saline, and immediately seek medical treatment; If you eat, immediately rinse, do not emesis, should immediately seek medical treatment. |