| Name | 5-Methyl-2-nitrophenol |
| Synonyms | 6-nitro-m-creso 6-Nitro-m-cresol 5-methyl-2-nitro-pheno 5-Methyl-2-nitrophenol 3-METHYL-6-NITROPHENOL 5-METHYL-2-NITROPHENOL 3-Methyl-6-nitrophenol phenol,5-methyl-2-nitro- 3-HYDROXY-4-NITROTOLUENE Phenol, 5-methyl-2-nitro- 5-methyl-2-nitrophenolate 3-Hydroxy-4-nitrotoluene 5-Methyl-2-nitrophenol (3-6) |
| CAS | 700-38-9 |
| EINECS | 211-843-0 |
| InChI | InChI=1/C7H7NO3/c1-5-2-3-6(8(10)11)7(9)4-5/h2-4,9H,1H3/p-1 |
| Molecular Formula | C7H7NO3 |
| Molar Mass | 153.14 |
| Density | 1.2744 (estimate) |
| Melting Point | 53-56°C(lit.) |
| Boling Point | 266.03°C (rough estimate) |
| Flash Point | 229°F |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.0122mmHg at 25°C |
| Appearance | Crystalline Chunks |
| Color | Yellow to greenish |
| BRN | 1868030 |
| pKa | pK1:7.41 (25°C,μ=0.1) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Stability | Hygroscopic |
| Refractive Index | 1.5744 (estimate) |
| Physical and Chemical Properties | Melting point 53-56°C flash point 109°C |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 2446 |
| WGK Germany | 3 |
| RTECS | SM1130950 |
| FLUKA BRAND F CODES | 10 |
| HS Code | 29089000 |
| Hazard Class | 6.1 |
| Packing Group | III |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| Use | 6-nitrom-cresol is a synthetic antifungal benzoxazine-4-4 (H)-General Chemical reagents for ketone derivatives. It is also used in the preparation of levofloxacin precursors. |