| Name | 5-chloro-1H-indazole |
| Synonyms | NSC 78434 BRN 0003260 5-CHLOROINDAZOLE 5-Chloroindazole 5-chloro-1h-indazol 5-Chloro-1H-indazole 5-chloro-1H-indazole 5-CHLORO (1H)INDAZOLE 5-Chloro (1H)Indazole 1H-Indazole, 5-chloro- 5-chloro-3a,7a-dihydro-1H-indazole 5-23-06-00175 (Beilstein Handbook Reference) |
| CAS | 698-26-0 |
| EINECS | 211-812-1 |
| InChI | InChI=1/C7H5ClN2/c8-6-1-2-7-5(3-6)4-9-10-7/h1-4H,(H,9,10) |
| Molecular Formula | C7H5ClN2 |
| Molar Mass | 152.58 |
| Density | 1.425±0.06 g/cm3(Predicted) |
| Melting Point | 119-120 °C(Solv: water (7732-18-5)) |
| Boling Point | 309.5±15.0 °C(Predicted) |
| Flash Point | 169.9°C |
| Vapor Presure | 0.00116mmHg at 25°C |
| pKa | 12.81±0.40(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.703 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| Hazard Class | IRRITANT |
| category | pesticide |
| toxicity classification | poisoning |
| acute toxicity | oral-mouse LD50: 2160 mg/kg |
| flammability hazard characteristics | Combustion produces toxic nitrogen oxides and chloride gases |
| storage and transportation characteristics | warehouse ventilation and low temperature drying; separate from food raw materials storage and transportation |
| fire extinguishing agent | dry powder, foam, sand |