| Name | Amines, tri-C8-10-alkyl |
| Synonyms | TA0810 Adogen 364 Azamine T 810 Einecs 272-347-8 (C8-10)trialkylamine Tri(octyl-decyl)amine Amines, tri-C8-10-alkyl N,N-dinonylnonan-1-amine Amines, tri-C(sub 8-10)-alkyl- |
| CAS | 68814-95-9 |
| EINECS | 272-347-8 |
| InChI | InChI=1/C27H57N/c1-4-7-10-13-16-19-22-25-28(26-23-20-17-14-11-8-5-2)27-24-21-18-15-12-9-6-3/h4-27H2,1-3H3 |
| Molecular Formula | C27H57N |
| Molar Mass | 395.748 |
| Density | 0.814[at 20℃] |
| Boling Point | 381.4℃[at 101 325 Pa] |
| Flash Point | 206.9°C |
| Water Solubility | 27μg/L at 20℃ |
| Vapor Presure | 0.001Pa at 20℃ |
| Refractive Index | 1.455 |
| UN IDs | 2735 |
| Hazard Class | 8 |
| Packing Group | III |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | trioctyl decyl tertiary amine is a colorless oily liquid which can be used as a noble metal extractant. In the metallurgical industry, it can be used for extractive separation of cobalt, nickel, actinides and lanthanides; It can also be used in organic synthesis. |