| Name | 2-Phenylanthraquinone |
| Synonyms | 2-Phenylanthraquinone 2-Phenylalanthraquinone 2-Phenyl-9,10-anthraquinone 2-Phenylanthra-9,10-Quinone 2-Phenylanthra-9,10-quinone 2-phenylanthracene-9,10-dione 2-Phenyl-9,10-anthracenedione 9,10-anthracenedione, 2-phenyl- 9,10-Anthracenedione, 2-phenyl- |
| CAS | 6485-97-8 |
| InChI | InChI=1/C20H12O2/c21-19-15-8-4-5-9-16(15)20(22)18-12-14(10-11-17(18)19)13-6-2-1-3-7-13/h1-12H |
| Molecular Formula | C20H12O2 |
| Molar Mass | 284.31 |
| Density | 1.267g/cm3 |
| Melting Point | 160-163°C |
| Boling Point | 506.8°C at 760 mmHg |
| Flash Point | 187.2°C |
| Vapor Presure | 2.16E-10mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Yellow to Green |
| Maximum wavelength(λmax) | ['340nm(lit.)'] |
| Storage Condition | Room Temprature |
| Refractive Index | 1.664 |
| MDL | MFCD00559262 |