| Name | 2,6-Dibromoanthraquinone |
| Synonyms | 2,6-Dibromoanthraqui 2,6-Dibromoanthraquinone 2,6-Dibromonathraquinone 2,6-DIBROMOANTHRAQUINONE 2,6-Dibromo Anthraquinone 2,6-Dibromoanthracene-9,1-dione 2,6-dibromoanthracene-9,10-dione 2,6-Dibromoanthracene-9,10-dione 9,10-Anthracenedione,2,6-dibroMo- 2,6-dibroMo-9,10-dihydroanthracene-9,10-dione 9,10-Anthracenedione, 2,6-dibroMo-2,6-DibroMoanthracene-9,10-dione |
| CAS | 633-70-5 |
| EINECS | 1592732-453-0 |
| InChI | InChI=1/C14H6Br2O2/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6H |
| Molecular Formula | C14H6Br2O2 |
| Molar Mass | 366 |
| Density | 1.911±0.06 g/cm3(Predicted) |
| Melting Point | 290 °C |
| Boling Point | 491.8±45.0 °C(Predicted) |
| Flash Point | 172.19°C |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | powder to crystal |
| Color | Light yellow to Brown |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.701 |
| Application | 2, 6-dibromoanthraquinone is an organic raw material, which can be widely used in the preparation of organic light-emitting materials. |
| preparation | 2, 6-dibromoanthraquinone can be prepared from 2, 6-diamino-9, 10-anthraquinone was prepared after diazotization reaction. 2, 6-diamino-9, 10-anthraquinone (5g,20.99mmol), tert-butyl nitrite (6.20ml,52.00mmol), Copper bromide (11.72g,52.50mmol) acetonitrile (300ml) was added to the reaction flask and reacted for 2H at 65 °c. 20% hydrochloric acid was added for quenching and the precipitate was filtered and washed with dichloromethane and brine. Recrystallization from 1, 4-dioxane gave 2, 6-dibromoanthraquinone (2.44g,30%). 1H NMR(400MHz,CDCl3): Δ8.44 (d,J = 1.2Hz,2H),8.17(d,J = 5.2Hz,2H),7.94(dd,J = 1.2,1.6Hz,2H). |