| Name | 5-Amino-6-nitroquinoline |
| Synonyms | TIMTEC-BB SBB000273 OTAVA-BB BB7110952630 6-NITRO-5-QUINOLINAMINE 6-NITROQUINOLIN-5-AMINE 6-nitroquinolin-5-amine 5-Amino-6-mitroquinoline 5-Amino-6-nitroquinoline 6-NITRO-5-QUINOLINEAMINE 6-nitroquinolin-5-ylamine 5-Quinolinamine, 6-nitro- N-dimethoxyphosphoryl-2-methoxyethanamine |
| CAS | 35975-00-9 |
| EINECS | 252-822-6 |
| InChI | InChI=1/C9H7N3O2/c10-9-6-2-1-5-11-7(6)3-4-8(9)12(13)14/h1-5H,10H2 |
| Molecular Formula | C9H7N3O2 |
| Molar Mass | 189.17 |
| Density | 1.3249 (rough estimate) |
| Melting Point | 272-273 °C (dec.) (lit.) |
| Boling Point | 324.42°C (rough estimate) |
| Flash Point | 201.4°C |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 6.5E-07mmHg at 25°C |
| Appearance | Solid |
| Color | Light Yellow to Yellow |
| BRN | 166360 |
| pKa | 3.81±0.15(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Stability | Hygroscopic |
| Refractive Index | 1.6500 (estimate) |
| MDL | MFCD00006798 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29334990 |
| Packing Group | III |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |