| Name | 6,13-pentacenequinone |
| Synonyms | 6,13-Pentacenedione 6,13-PENTACENEDIONE 6,13-Pntacenequinone pentacene-6,13-dione pentacene-6,13-dione 6,13-PENTACENEQUINONE 6,13-pentacenequinone 6,13-Dihydropentacene-6,13-dione 6,13-Pentacenequinone6,13-Pentacenedione |
| CAS | 3029-32-1 |
| InChI | InChI=1/C22H12O2/c23-21-17-9-13-5-1-2-6-14(13)10-18(17)22(24)20-12-16-8-4-3-7-15(16)11-19(20)21/h1-12H |
| InChIKey | UFCVADNIXDUEFZ-UHFFFAOYSA-N |
| Molecular Formula | C22H12O2 |
| Molar Mass | 308.33 |
| Density | 1.2343 (rough estimate) |
| Melting Point | 394 °C |
| Boling Point | 388.73°C (rough estimate) |
| Flash Point | 204.1°C |
| Water Solubility | insoluble |
| Vapor Presure | 1.82E-12mmHg at 25°C |
| Appearance | Powder |
| Color | Yellow |
| Storage Condition | Sealed in dry,Room Temperature |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive Index | 1.5344 (estimate) |
| MDL | MFCD00003709 |
| Use | Precursor Field Effect of Diarylpentacene (diarylpentacenes) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29146990 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |