| Name | N-Benzyloxycarbonyl-D-phenylanlaninol |
| Synonyms | Cbz-D-Phenylalanino Cbz-D-Phenylalaninol N-CBZ-D-PHENYLALANINOL N-CARBOBENZOXY-D-PHENYLALANINOL N-(CARBOBENZYLOXY)-D-PHENYLALANINOL N-Benzyloxycarbonyl-D-phenylanlaninol (R)-(+)-2-(Cbz-aMino)-3-phenyl-1-propanol Benzyl [(2R)-1-hydroxy-3-phenylpropan-2-yl]carbamate Carbamic acid, N-[(1R)-2-hydroxy-1-(phenylmethyl)ethyl]-, phenylmethyl ester (R)-N-Carbobenzoxy-2-amino-3-phenyl-1-propanol(R)-N-Cbz-2-amino-3-phenyl-1-propanolN-Cbz-D-phenylalaninol |
| CAS | 58917-85-4 |
| EINECS | 1533716-785-6 |
| InChI | InChI=1/C17H19NO3/c19-12-16(11-14-7-3-1-4-8-14)18-17(20)21-13-15-9-5-2-6-10-15/h1-10,16,19H,11-13H2,(H,18,20)/t16-/m1/s1 |
| Molecular Formula | C17H19NO3 |
| Molar Mass | 285.34 |
| Density | 1.0864 (rough estimate) |
| Melting Point | 92-95°C |
| Boling Point | 427.77°C (rough estimate) |
| Specific Rotation(α) | 30 º (c=1 in chloroform) |
| Flash Point | 249.6°C |
| Solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| Vapor Presure | 2.23E-10mmHg at 25°C |
| Appearance | White powder |
| Color | White |
| BRN | 2221968 |
| pKa | 11.86±0.46(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 42 ° (C=2, MeOH) |
| MDL | MFCD00191193 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-23 |
| HS Code | 29051990 |