| Name | 5-methylisoxazole-3-carbonitrile |
| Synonyms | 3-Cyano-5-methylisoxazole 5-methylisoxazole-3-carbonitrile 5-Methyl-3-isoxazolecarbonitrile 3-Isoxazolecarbonitrile, 5-methyl- 5-methyl-1,2-oxazole-3-carbonitrile |
| CAS | 57351-99-2 |
| InChI | InChI=1/C5H4N2O/c1-4-2-5(3-6)7-8-4/h2H,1H3 |
| Molecular Formula | C5H4N2O |
| Molar Mass | 108.1 |
| Density | 1.18±0.1 g/cm3(Predicted) |
| Boling Point | 249.4±20.0 °C(Predicted) |
| Flash Point | 104.6°C |
| Vapor Presure | 0.023mmHg at 25°C |
| pKa | -6.83±0.50(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.488 |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S23 - Do not breathe vapour. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | 3276 |
| HS Code | 29349990 |
| Hazard Note | Harmful |
| Hazard Class | 6.1 |