| Name | 3-Amino-2-naphthol |
| Synonyms | 3-Amino-2-naphthol 3-AMINO-2-NAPHTHOL 2-Naphthol, 3-amino- LABOTEST-BB LT00080648 3-Amino-naphthalen-2-ol 2-Naphthalenol, 3-amino- 3-HYDROXY-2-NAPHTHYLAMINE 2-AMINO-3-HYDROXYNAPHTHALENE 3-AMINO-2-HYDROXYNAPHTHALENE 2-Hydroxy-3-aminonaphthalene |
| CAS | 5417-63-0 |
| EINECS | 226-519-4 |
| InChI | InChI=1S/C10H9NO/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-6,12H,11H2 |
| Molecular Formula | C10H9NO |
| Molar Mass | 159.18 |
| Density | 1.281±0.06 g/cm3(Predicted) |
| Melting Point | 229-230 °C (lit.) |
| Boling Point | 343.5±25.0 °C(Predicted) |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Appearance | Solid |
| Color | Pale Beige to Beige |
| pKa | 9.36±0.40(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| MDL | MFCD00004113 |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. R40 - Limited evidence of a carcinogenic effect |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| WGK Germany | 3 |
| HS Code | 29222990 |
| Hazard Note | Harmful/Irritant |
| Hazard Class | IRRITANT |