| Name | 5-Fluoro-2-iodobenzoic acid |
| Synonyms | 5-Fluoro-2-iodobenzoic acid Benzoic acid, 5-fluoro-2-iodo- benzoic acid, 5-fluoro-2-iodo- |
| CAS | 52548-63-7 |
| InChI | InChI=1/C7H4FIO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) |
| Molecular Formula | C7H4FIO2 |
| Molar Mass | 266.01 |
| Density | 2.074±0.06 g/cm3(Predicted) |
| Melting Point | 145-149 °C |
| Boling Point | 307.9±27.0 °C(Predicted) |
| Flash Point | 140.01°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 2.52±0.10(Predicted) |
| Storage Condition | 2-8°C(protect from light) |
| Sensitive | Light Sensitive |
| Refractive Index | 1.638 |
| MDL | MFCD00837316 |
| Hazard Symbols | T - Toxic![]() |
| Risk Codes | R25 - Toxic if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2811 |
| WGK Germany | 3 |
| Hazard Class | 6.1 |
| Packing Group | Ⅲ |