| Name | 2,5-Dichlorophenylhydrazine hydrochloride |
| Synonyms | 2,5-Dichlorophenylhy 2,5-DICHLOROPHENYLHYDRAZINE HCL 2,5-Dichlorophenylhydrazinehydrochloride 2,5-DICHLOROPHENYLHYDRAZINE HYDROCHLORIDE 2,5-Dichoropheynylhydrazine hydrochloride 2,5-Dichlorophenylhydrazine hydrochloride (2,5-dichlorophenyl)hydrazine monohydrochloride |
| CAS | 50709-35-8 |
| EINECS | 256-729-1 |
| InChI | InChI=1/C6H6Cl2N2.ClH/c7-4-1-2-5(8)6(3-4)10-9;/h1-3,10H,9H2;1H |
| Molecular Formula | C6H7Cl3N2 |
| Molar Mass | 213.49 |
| Melting Point | 208°C (dec.)(lit.) |
| Boling Point | 266.8°C at 760 mmHg |
| Flash Point | 115.1°C |
| Vapor Presure | 0.00848mmHg at 25°C |
| Appearance | Solid |
| Storage Condition | Inert atmosphere,Room Temperature |
| MDL | MFCD00052266 |
| Use | Used as an intermediate in organic synthesis |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S27 - Take off immediately all contaminated clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 29280000 |
| Overview | 2,5-dichlorophenylhydrazine hydrochloride is an organic chemical substance that can be used as an intermediate in organic chemistry. |
| Use | Used as an intermediate in organic synthesis |