| Name | 5-formyluracil |
| Synonyms | AURORA KA-650 5-formyluracil 5-FORMILURACIL 5-FORMYLURACIL RARECHEM AH CK 0106 Uracil-5-carboxaldehyde 5-pyrimidinecarboxaldehyde 5- Pyrimidinecarboxaldehyde 2,4-dihydroxypyrimidine-5-carbaldehyde 1,2,3,4-TETRAHYDRO-2,4-DIOXOPYRIMIDINE-5-CARBALDEHYDE 2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbaldehyde 5-Pyrimidinecarboxaldehyde, 1,2,3,4-tetrahydro-2,4-dioxo- (6CI,7CI,8CI,9CI) |
| CAS | 1195-08-0 |
| InChI | InChI=1/C5H4N2O3/c8-2-3-1-6-5(10)7-4(3)9/h1-2H,(H2,6,7,9,10) |
| InChIKey | OHAMXGZMZZWRCA-UHFFFAOYSA-N |
| Molecular Formula | C5H4N2O3 |
| Molar Mass | 140.1 |
| Density | 1.567±0.06 g/cm3(Predicted) |
| Melting Point | >300 °C (dec.) (lit.) |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Appearance | White to white-like powder |
| Color | White to Pale Yellow |
| pKa | 7.27±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Store in freezer, under -20°C |
| Sensitive | Air Sensitive |
| Refractive Index | 1.625 |
| MDL | MFCD00192185 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Hazard Note | Irritant |
| use | 5-formyluracil is a 5-substituted uridine derivative, which has been explored as a potential application for antiviral drugs and tumor therapy. |