| Name | Pyridine, 5-(3-fluorophenyl)-2-methyl- |
| Synonyms | 5-(3-Fluorophenyl) 5-(3-FLUOROPHENYL)-2-METHYLPYRIDINE 5-(3-Fluorophenyl)-2-methyl-pyridin Pyridine, 5-(3-fluorophenyl)-2-methyl- |
| CAS | 713143-67-0 |
| InChI | InChI=1/C12H10FN/c1-9-5-6-11(8-14-9)10-3-2-4-12(13)7-10/h2-8H,1H3 |
| Molecular Formula | C12H10FN |
| Molar Mass | 187.21 |
| Density | 1.111±0.06 g/cm3(Predicted) |
| Boling Point | 284.5±25.0 °C(Predicted) |
| Flash Point | 125.9°C |
| Vapor Presure | 0.00508mmHg at 25°C |
| pKa | 5.05±0.11(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.551 |
| Use | 5-(trifluorophenyl)-2-methylpyridine is a pyridine derivative and can be used as a pharmaceutical intermediate. |