| Name | 2-Bromo-5-fluorotoluene |
| Synonyms | 2-BROMO-5-FLUOROTOLUENE 2-Bromo-5-fluorotoluene 3-FLUORO-6-BROMOTOLUENE 2-BROMO-5-FULUOROTOLRENE 2-Bromo-5-fuluorotoluene 1-BROMO-4-FLUORO-2-METHYLBENZENE 4-chloro-1-fluoro-2-methylbenzene Benzene, 1-bromo-4-fluoro-2-methyl- |
| CAS | 452-63-1 |
| EINECS | 207-203-5 |
| InChI | InChI=1/C7H6BrF/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| Molecular Formula | C7H6BrF |
| Molar Mass | 189.02 |
| Density | 1.495 g/mL at 25 °C (lit.) |
| Boling Point | 177 °C/756 mmHg (lit.) |
| Flash Point | 113°F |
| Water Solubility | INSOLUBLE |
| Solubility | Difficult to mix. |
| Vapor Presure | 2.8mmHg at 25°C |
| Specific Gravity | 1.495 |
| BRN | 1859121 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.526(lit.) |
| Physical and Chemical Properties | Density: 1.49 Boiling Point: 176-177 ° C. (756 mmHg) refractive index: 1.527-1.529 flash point: 44°C water-soluble INSOLUBLE |
| Use | Used as pharmaceutical, pesticide intermediates |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R10 - Flammable R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HS Code | 29049090 |
| Hazard Note | Irritant |
| Hazard Class | 3 |
| Packing Group | III |
| chemical properties | colorless or light yellow liquid |
| Use | Used as an intermediate in medicine and pesticide |
| NIST chemical substance information | The information is: webbook.nist.gov provides (external link) |