| Name | 2,3-difluorobenzenamine |
| Synonyms | 2,3-Difluoroaniline 2,3-difluoroaniline 2,3-DIFLUOROANILINE TIMTEC-BB SBB006565 2,3-Difluorobenzenamine 2,3-difluorophenylamine 2,3-difluorobenzenamine Benzenamine, 2,3-difluoro- |
| CAS | 4519-40-8 |
| EINECS | 224-847-2 |
| InChI | InChI=1/C6H5F2N/c7-4-2-1-3-5(9)6(4)8/h1-3H,9H2 |
| Molecular Formula | C6H5F2N |
| Molar Mass | 129.11 |
| Density | 1.274 g/mL at 25 °C (lit.) |
| Boling Point | 68-69 °C |
| Flash Point | 160°F |
| Vapor Presure | 1.08mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 1.274 |
| Color | Clear light orange |
| BRN | 2716500 |
| pKa | 2.19±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | n20/D 1.514(lit.) |
| MDL | MFCD00010298 |
| Physical and Chemical Properties | Density 1.274 boiling point 68-69°C refractive index 1.512-1.514 flash point 71°C |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S27 - Take off immediately all contaminated clothing. S28 - After contact with skin, wash immediately with plenty of soap-suds. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S36 - Wear suitable protective clothing. |
| UN IDs | 2941 |
| WGK Germany | 3 |
| HS Code | 29214200 |
| Hazard Note | Irritant |
| Hazard Class | 6.1 |
| Packing Group | III |
| chemical properties | flash point 71 ℃, refractive index 1.5140, specific gravity 1.274. |