| Name | benzofuran-2-carboxaldehyde |
| Synonyms | 2-Formylbenzofuran RARECHEM AM LA 0016 TIMTEC-BB SBB010059 2-Benzofurancarboxaldehyde 2-BENZOFURANCARBOXALDEHYDE benzofuran-2-carboxaldehyde 1-benzofuran-2-carbaldehyde 1-Benzofuran-2-carboxaldehyde, 2-Formylbenzo[b]furan |
| CAS | 4265-16-1 |
| EINECS | 224-248-6 |
| InChI | InChI=1/C9H6O2/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-6H |
| Molecular Formula | C9H6O2 |
| Molar Mass | 146.15 |
| Density | 1.206g/mLat 25°C(lit.) |
| Melting Point | 9-9.5 °C |
| Boling Point | 135°C18mm Hg(lit.) |
| Flash Point | >230°F |
| JECFA Number | 751 |
| Water Solubility | Not miscible or difficult to mix with water. |
| Vapor Presure | 0.0203mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 1.206 |
| Color | Clear yellow to brown |
| BRN | 2910 |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.633(lit.) |
| MDL | MFCD00015463 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29329990 |
| Hazard Class | IRRITANT |
| FEMA | 3128 | 2-BENZOFURANCARBOXALDEHYDE |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| toxicity | GRAS(FEMA). |
| usage limit | FEMA(mg/kg): cold drinks, candy, jelly, pudding, 10; Baked products, 20. |