| Name | cis-3-hexenyl isobutyrate |
| Synonyms | VERDURAL B cis-3-Hexenylester cis-3-Hexenyl i-butyrate (Z)-Hex-3-enylisobutyrat cis-3-hexenyl isobutyrate CIS 3 HEXENYL ISOBUTYRATE (Z)-HEX-3-ENYL ISOBUTYRATE Isobutyricacidcishexenylester (3Z)-hex-3-en-1-yl 2-methylpropanoate Isobutyric acid cis-3-hexen-1-yl ester Propanoic acid, 2-methyl-, (3Z)-3-hexenyl ester |
| CAS | 41519-23-7 |
| EINECS | 255-424-0 |
| InChI | InChI=1/C10H18O2/c1-4-5-6-7-8-12-10(11)9(2)3/h5-6,9H,4,7-8H2,1-3H3/b6-5- |
| Molecular Formula | C10H18O2 |
| Molar Mass | 170.25 |
| Density | 0.878g/mLat 25°C(lit.) |
| Melting Point | -89.9°C (estimate) |
| Boling Point | 92°C20mm Hg(lit.) |
| Flash Point | 185°F |
| JECFA Number | 1275 |
| Vapor Presure | 2.16-2.73hPa at 20-25℃ |
| Appearance | Liquid |
| Color | Colorless to Light yellow |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.428(lit.) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 38 - Irritating to the skin |
| Safety Description | 36 - Wear suitable protective clothing. |
| WGK Germany | 2 |
| RTECS | UA2470200 |
| HS Code | 29156000 |
| FEMA | 3929 | CIS-3-HEXENYL ISOBUTYRATE |
| LogP | 3.4 at 35℃ and pH7 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |