| Name | Isobutylbenzaldehyde |
| Synonyms | Of iso-benzaldehyde Isobutylbenzaldehyde isobutylbenzaldehyde P-ISOBUTYLBENZALDEHYDE 4-lsobutylbenzaldehyde 4-ISOBUTYLBENZALDEHYDE 4-Isobutylbenzaldehyde 4-(2-methylpropyl)benzaldehyde 4-(2-Methylpropyl)benzaldehyde 1-Formyl-4-(2-methylpropyl)benzene |
| CAS | 40150-98-9 |
| EINECS | 609-787-0 |
| InChI | InChI=1/C11H14O/c1-9(2)7-10-3-5-11(8-12)6-4-10/h3-6,8-9H,7H2,1-2H3 |
| Molecular Formula | C11H14O |
| Molar Mass | 162.23 |
| Density | 0,96 g/cm3 |
| Boling Point | 258 °C |
| Flash Point | 100.8°C |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.0208mmHg at 25°C |
| Appearance | Oil |
| Color | Clear Colourless |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | 1.5210-1.5250 |
| MDL | MFCD00075760 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |